Palladium/norbornene chemistry: an unexpected route to methanocarbazole derivatives via three Csp3-Csp2/Csp3-N/Csp2-N bond formations in a single synthetic sequence.

ABSTRACT

A Catellani reaction terminated by palladacycle amination leading to methanocarbazoles is reported. The outcome is the formation of three different Csp(3)-Csp(2)/Csp(3)-N/Csp(2)-N bonds through a Heck reaction/C-H activation/double amination cascade in one process.